1. Product information
| Product Name: | 4-Chloro-2-iodoaniline |
| Synonyms: | 2-IODO-4-CHLOROANILINE;4-Chloro-2-iodobenzenamine;4-CHLORO-2-IODOANILINE;4-CHLORO-2-IODOANILINE 98%;4-Chloro-2-iodoaniline,98+%;4-Chloro-2-iodoanili;2-iodine-4-chloroaniline;4-chloro-2-iodoaniline hydrochloride |
| CAS: | 63069-48-7 |
| MF: | C6H5ClIN |
| MW: | 253.47 |
| EINECS: | 263-839-3 |
| Product Categories: | Miscellaneous;Anilines, Amides & Amines;Chlorine Compounds;Iodine Compounds;Amines;C2 to C6;Nitrogen Compounds |
| Mol File: | 63069-48-7.mol |
 |
|
| 4-Chloro-2-iodoaniline Chemical Properties |
| Melting point | 40 °C |
| Boiling point | 295.0±25.0 °C(Predicted) |
| density | 2.015±0.06 g/cm3(Predicted) |
| Fp | >110 °C |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 1.90±0.10(Predicted) |
| color | White to off-white |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C6H5ClIN/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2 |
| InChIKey | FLEJOBRWKBPUOX-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Cl)C=C1I |
| CAS DataBase Reference | 63069-48-7(CAS DataBase Reference) |
| Hazard Codes | Xi,N,T |
| Risk Statements | 20/21/22-36/37/38-51/53-41-37/38-25 |
| Safety Statements | 26-36/37/39-61-45 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
|
| 4-Chloro-2-iodoaniline Usage And Synthesis |
| Chemical Properties | Pale brown to purple low melting solid |
2. Packaging
For powders: normal is 25kgs/Drum or bag, or larger/smaller package as request.
For liquids: normal 25kgs/drum, 180-300kgs/bucket, or IBC, determined by the nature of the product.
Or smaller package 1kg/bottle, 10kgs/bottle as request.
3. Shipping
4. Contact information
For more details, pls contact us freely.
Email address : elin@fdachem.com
Mob: 86 13613820652
WhatsApp/Skype/Wechat/LINE: 86 13613820652
China
