| Product Name: | 1,3-Benzodioxole-5-acetic acid, α-acetyl-, methyl ester |
| Synonyms: | 1,3-Benzodioxole-5-acetic acid, α-acetyl-, methyl ester;1,3-Benzodioxole-5-acetic acid, α-acetyl-, methyl ester;NEW PMK-1,3-Benzodioxole-5-acetic acid, α-acetyl-, methyl ester;PMK;Great PMK;1,3-Benzodioxole-5-acetic acid, α-acety;PMK, 1,3-Benzodioxole-5-acetic acid, α-acetyl-, methyl ester;NEW PMK-1,3-Benzodioxole-5-acetic acid |
| CAS: | 1369021-80-6 |
| MF: | C12H12O5 |
| MW: | 236.22 |
| EINECS: | 234-232-0 |
| Product Categories: |
|
| Mol File: | 1369021-80-6.mol |
 |
|
| 1,3-Benzodioxole-5-acetic acid, α-acetyl-, methyl ester Chemical Properties |
| Boiling point | 330.6±42.0 °C(Predicted) |
| density | 1.281±0.06 g/cm3(Predicted) |
| pka | 10.98±0.20(Predicted) |
| InChI | InChI=1S/C12H12O5/c1-7(13)11(12(14)15-2)8-3-4-9-10(5-8)17-6-16-9/h3-5,11H,6H2,1-2H3 |
| InChIKey | NNJCEJQSUYRXMB-UHFFFAOYSA-N |
Advantages:
1. Samples are provided for test;
2. Good quality products;
3. 100% secure delivery.
4. secure your money, lower the risk
5.Payment ways: Western Union, Moneygram, Bitcoin, T/T，USDT、PAYPAL
6.Delivery: EMS/ EUB/ USPS/ UPS/ TNT/ FEDEX/ DHL /DPDetc
7.Packaging:safe and discreet packaging
Our company Superiority
1 Best service, high quality and reasonable price
2. It's customers' right to choose the package (EMS, DHL, FedEx, UPS);
3. It's customers' right to choose the packing way for his products from many recent effective packing ways
4. Specials are possible when client's order is big enough, including the discount policy;
5.Our company promise to deliver clients' package to his hands safely, or we'll cover the total loss and reship in time;
Our company supply high quality chemical products with the most competitive prices.
If have any need or question, contact us freely.
Hope we can have chances to build good long-term cooperation.
China
